C45H82N2O8 — CID 76688056
octadec-9-enyl 3-[4-[(3-hept-4-enoxy-3-oxopropyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 76688056) has the molecular formula C45H82N2O8 and a molecular weight of 779.16 g/mol. Its IUPAC name is octadec-9-enyl 3-[4-[(3-hept-4-enoxy-3-oxopropyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | octadec-9-enyl 3-[4-[(3-hept-4-enoxy-3-oxopropyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 76688056 |
| Molecular Formula | C45H82N2O8 |
| Molecular Weight | 779.16 g/mol |
| Exact Mass | 778.61 |
| IUPAC Name | octadec-9-enyl 3-[4-[(3-hept-4-enoxy-3-oxopropyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | CCC=CCCCOC(=O)CCN(CCCCN(CCC(=O)OCCCCCCCCC=CCCCCCCCC)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C45H82N2O8/c1-9-11-13-15-16-17-18-19-20-21-22-23-24-25-27-31-39-53-41(49)33-37-47(43(51)55-45(6,7)8)35-29-28-34-46(42(50)54-44(3,4)5)36-32-40(48)52-38-30-26-14-12-10-2/h12,14,19-20H,9-11,13,15-18,21-39H2,1-8H3 |
| InChIKey | IRDINUNLOQSXLE-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.16 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|