About 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate
3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate (PubChem CID 138657931) has the molecular formula C30H55NO6
and a molecular weight of 525.77 g/mol. Its IUPAC name is 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate |
| PubChem CID | 138657931 |
| Molecular Formula | C30H55NO6 |
| Molecular Weight | 525.77 g/mol |
| Exact Mass | 525.40 |
| IUPAC Name | 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCN(CCCOC=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H55NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-28(33)36-26-21-24-31(23-20-25-35-27-32)29(34)37-30(2,3)4/h12-13,27H,5-11,14-26H2,1-4H3/b13-12- |
| InChIKey | ZWAVQDUOXVZMCJ-SEYXRHQNSA-N |
| XLogP | 7.76 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 525.77 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate?
The IUPAC name of 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate (CID 138657931) is 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate.
What is the SMILES notation for 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate?
The canonical SMILES for 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OCCCN(CCCOC=O)C(=O)OC(C)(C)C.
What is the InChIKey of 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate?
The InChIKey is ZWAVQDUOXVZMCJ-SEYXRHQNSA-N. The full InChI is InChI=1S/C30H55NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-28(33)36-26-21-24-31(23-20-25-35-27-32)29(34)37-30(2,3)4/h12-13,27H,5-11,14-26H2,1-4H3/b13-12-.
What are the key properties of 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate?
3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate has a molecular weight of 525.77 g/mol, XLogP of 7.76, 24 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-formyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl (Z)-octadec-9-enoate is sourced from PubChem (CID 138657931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).