C46H92N8O4 — CID 101359409
(Z)-N-[3-[[(2S)-2,6-diaminohexanoyl]-[4-[[(2S)-2,6-diaminohexanoyl]-[3-(hexanoylamino)propyl]amino]butyl]amino]propyl]octadec-9-enamide (PubChem CID 101359409) has the molecular formula C46H92N8O4 and a molecular weight of 821.29 g/mol. Its IUPAC name is (Z)-N-[3-[[(2S)-2,6-diaminohexanoyl]-[4-[[(2S)-2,6-diaminohexanoyl]-[3-(hexanoylamino)propyl]amino]butyl]amino]propyl]octadec-9-enamide.
| Compound Name | (Z)-N-[3-[[(2S)-2,6-diaminohexanoyl]-[4-[[(2S)-2,6-diaminohexanoyl]-[3-(hexanoylamino)propyl]amino]butyl]amino]propyl]octadec-9-enamide |
|---|---|
| PubChem CID | 101359409 |
| Molecular Formula | C46H92N8O4 |
| Molecular Weight | 821.29 g/mol |
| Exact Mass | 820.72 |
| IUPAC Name | (Z)-N-[3-[[(2S)-2,6-diaminohexanoyl]-[4-[[(2S)-2,6-diaminohexanoyl]-[3-(hexanoylamino)propyl]amino]butyl]amino]propyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCCN(CCCCN(CCCNC(=O)CCCCC)C(=O)[C@@H](N)CCCCN)C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C46H92N8O4/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-20-32-44(56)52-36-28-40-54(46(58)42(50)30-22-24-34-48)38-26-25-37-53(45(57)41(49)29-21-23-33-47)39-27-35-51-43(55)31-19-6-4-2/h12-13,41-42H,3-11,14-40,47-50H2,1-2H3,(H,51,55)(H,52,56)/b13-12-/t41-,42-/m0/s1 |
| InChIKey | KOGRDQVLNYBBKS-NVIXFXDISA-N |
| XLogP | 6.97 |
| TPSA | 202.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.29 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|