C26H55N7O3 — CID 129148802
N,N-bis[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl]octanamide (PubChem CID 129148802) has the molecular formula C26H55N7O3 and a molecular weight of 513.77 g/mol. Its IUPAC name is N,N-bis[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl]octanamide.
| Compound Name | N,N-bis[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl]octanamide |
|---|---|
| PubChem CID | 129148802 |
| Molecular Formula | C26H55N7O3 |
| Molecular Weight | 513.77 g/mol |
| Exact Mass | 513.44 |
| IUPAC Name | N,N-bis[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl]octanamide |
| SMILES | CCCCCCCC(=O)N(CCCNC(=O)[C@@H](N)CCCCN)CCCNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C26H55N7O3/c1-2-3-4-5-6-15-24(34)33(20-11-18-31-25(35)22(29)13-7-9-16-27)21-12-19-32-26(36)23(30)14-8-10-17-28/h22-23H,2-21,27-30H2,1H3,(H,31,35)(H,32,36)/t22-,23-/m0/s1 |
| InChIKey | JTYOXHFWIMQCRV-GOTSBHOMSA-N |
| XLogP | 1.10 |
| TPSA | 182.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.77 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|