C44H73N9O5 — CID 129151968
N,N-bis[3-[[(2R)-2-[[(2R)-2,6-diaminohexanoyl]amino]-3-phenylpropanoyl]amino]propyl]octanamide (PubChem CID 129151968) has the molecular formula C44H73N9O5 and a molecular weight of 808.13 g/mol. Its IUPAC name is N,N-bis[3-[[(2R)-2-[[(2R)-2,6-diaminohexanoyl]amino]-3-phenylpropanoyl]amino]propyl]octanamide.
| Compound Name | N,N-bis[3-[[(2R)-2-[[(2R)-2,6-diaminohexanoyl]amino]-3-phenylpropanoyl]amino]propyl]octanamide |
|---|---|
| PubChem CID | 129151968 |
| Molecular Formula | C44H73N9O5 |
| Molecular Weight | 808.13 g/mol |
| Exact Mass | 807.57 |
| IUPAC Name | N,N-bis[3-[[(2R)-2-[[(2R)-2,6-diaminohexanoyl]amino]-3-phenylpropanoyl]amino]propyl]octanamide |
| SMILES | CCCCCCCC(=O)N(CCCNC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](N)CCCCN)CCCNC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](N)CCCCN |
| InChI | InChI=1S/C44H73N9O5/c1-2-3-4-5-12-25-40(54)53(30-17-28-49-43(57)38(32-34-19-8-6-9-20-34)51-41(55)36(47)23-13-15-26-45)31-18-29-50-44(58)39(33-35-21-10-7-11-22-35)52-42(56)37(48)24-14-16-27-46/h6-11,19-22,36-39H,2-5,12-18,23-33,45-48H2,1H3,(H,49,57)(H,50,58)(H,51,55)(H,52,56)/t36-,37-,38-,39-/m1/s1 |
| InChIKey | HCMZEBVIBPWSAM-WRCAVZGJSA-N |
| XLogP | 2.56 |
| TPSA | 240.79 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.13 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|