C36H71N7O3 — CID 129148822
(9E,12E)-N,N-bis[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl]octadeca-9,12-dienamide (PubChem CID 129148822) has the molecular formula C36H71N7O3 and a molecular weight of 650.01 g/mol. Its IUPAC name is (9E,12E)-N,N-bis[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl]octadeca-9,12-dienamide.
| Compound Name | (9E,12E)-N,N-bis[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 129148822 |
| Molecular Formula | C36H71N7O3 |
| Molecular Weight | 650.01 g/mol |
| Exact Mass | 649.56 |
| IUPAC Name | (9E,12E)-N,N-bis[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl]octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)N(CCCNC(=O)[C@@H](N)CCCCN)CCCNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C36H71N7O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-25-34(44)43(30-21-28-41-35(45)32(39)23-17-19-26-37)31-22-29-42-36(46)33(40)24-18-20-27-38/h6-7,9-10,32-33H,2-5,8,11-31,37-40H2,1H3,(H,41,45)(H,42,46)/b7-6+,10-9+/t32-,33-/m0/s1 |
| InChIKey | RSRQFUAEBYWRTH-IFTPGUFJSA-N |
| XLogP | 4.55 |
| TPSA | 182.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.01 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|