C53H103N9O5 — CID 58152588
(Z)-N-[3-[[2-[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl-[(6S)-6,10-diamino-5-oxodecyl]amino]acetyl]-[4-[[(Z)-hept-4-enoyl]amino]butyl]amino]propyl]octadec-9-enamide (PubChem CID 58152588) has the molecular formula C53H103N9O5 and a molecular weight of 946.46 g/mol. Its IUPAC name is (Z)-N-[3-[[2-[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl-[(6S)-6,10-diamino-5-oxodecyl]amino]acetyl]-[4-[[(Z)-hept-4-enoyl]amino]butyl]amino]propyl]octadec-9-enamide.
| Compound Name | (Z)-N-[3-[[2-[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl-[(6S)-6,10-diamino-5-oxodecyl]amino]acetyl]-[4-[[(Z)-hept-4-enoyl]amino]butyl]amino]propyl]octadec-9-enamide |
|---|---|
| PubChem CID | 58152588 |
| Molecular Formula | C53H103N9O5 |
| Molecular Weight | 946.46 g/mol |
| Exact Mass | 945.81 |
| IUPAC Name | (Z)-N-[3-[[2-[3-[[(2S)-2,6-diaminohexanoyl]amino]propyl-[(6S)-6,10-diamino-5-oxodecyl]amino]acetyl]-[4-[[(Z)-hept-4-enoyl]amino]butyl]amino]propyl]octadec-9-enamide |
| SMILES | CC/C=C\CCC(=O)NCCCCN(CCCNC(=O)CCCCCCC/C=C\CCCCCCCC)C(=O)CN(CCCCC(=O)[C@@H](N)CCCCN)CCCNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C53H103N9O5/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-21-36-51(65)59-40-31-45-62(44-29-27-39-58-50(64)35-20-8-6-4-2)52(66)46-61(42-28-24-34-49(63)47(56)32-22-25-37-54)43-30-41-60-53(67)48(57)33-23-26-38-55/h6,8,13-14,47-48H,3-5,7,9-12,15-46,54-57H2,1-2H3,(H,58,64)(H,59,65)(H,60,67)/b8-6-,14-13-/t47-,48-/m0/s1 |
| InChIKey | SXVQDOBPNXBMAQ-ZSNOGGKVSA-N |
| XLogP | 7.46 |
| TPSA | 232.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.46 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|