C21H34N6O5 — CID 175696016
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 175696016) has the molecular formula C21H34N6O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175696016 |
| Molecular Formula | C21H34N6O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H34N6O5/c22-11-5-4-10-16(20(30)31)26-19(29)17(13-14-7-2-1-3-8-14)27-18(28)15(23)9-6-12-25-21(24)32/h1-3,7-8,15-17H,4-6,9-13,22-23H2,(H,26,29)(H,27,28)(H,30,31)(H3,24,25,32)/t15-,16-,17-/m0/s1 |
| InChIKey | QIQLQOIFWJWBBM-ULQDDVLXSA-N |
| XLogP | -0.81 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|