C22H36N6O5 — CID 175695977
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-4-phenylbutanoyl]amino]hexanoic acid (PubChem CID 175695977) has the molecular formula C22H36N6O5 and a molecular weight of 464.57 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-4-phenylbutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-4-phenylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175695977 |
| Molecular Formula | C22H36N6O5 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-4-phenylbutanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CCc1ccccc1)NC(=O)[C@@H](N)CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C22H36N6O5/c23-13-5-4-10-18(21(31)32)28-20(30)17(12-11-15-7-2-1-3-8-15)27-19(29)16(24)9-6-14-26-22(25)33/h1-3,7-8,16-18H,4-6,9-14,23-24H2,(H,27,29)(H,28,30)(H,31,32)(H3,25,26,33)/t16-,17-,18-/m0/s1 |
| InChIKey | GVAVYEBIUCDGTF-BZSNNMDCSA-N |
| XLogP | -0.42 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|