C47H91N3O6 — CID 175542588
2-[bis[(Z)-octadec-9-enyl]amino]pentanedioic acid;2,6-diaminohexanoic acid (PubChem CID 175542588) has the molecular formula C47H91N3O6 and a molecular weight of 794.26 g/mol. Its IUPAC name is 2-[bis[(Z)-octadec-9-enyl]amino]pentanedioic acid;2,6-diaminohexanoic acid.
| Compound Name | 2-[bis[(Z)-octadec-9-enyl]amino]pentanedioic acid;2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 175542588 |
| Molecular Formula | C47H91N3O6 |
| Molecular Weight | 794.26 g/mol |
| Exact Mass | 793.69 |
| IUPAC Name | 2-[bis[(Z)-octadec-9-enyl]amino]pentanedioic acid;2,6-diaminohexanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(CCCCCCCC/C=C\CCCCCCCC)C(CCC(=O)O)C(=O)O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C41H77NO4.C6H14N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-42(39(41(45)46)35-36-40(43)44)38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;7-4-2-1-3-5(8)6(9)10/h17-20,39H,3-16,21-38H2,1-2H3,(H,43,44)(H,45,46);5H,1-4,7-8H2,(H,9,10)/b19-17-,20-18-; |
| InChIKey | DILVSAPJUJOPSG-AWLASTDMSA-N |
| XLogP | 12.21 |
| TPSA | 167.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.26 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|