C23H45NO5 — CID 174664622
2-aminopentanedioic acid;(Z)-octadec-9-en-1-ol (PubChem CID 174664622) has the molecular formula C23H45NO5 and a molecular weight of 415.62 g/mol. Its IUPAC name is 2-aminopentanedioic acid;(Z)-octadec-9-en-1-ol.
| Compound Name | 2-aminopentanedioic acid;(Z)-octadec-9-en-1-ol |
|---|---|
| PubChem CID | 174664622 |
| Molecular Formula | C23H45NO5 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | 2-aminopentanedioic acid;(Z)-octadec-9-en-1-ol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCO.NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H36O.C5H9NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;6-3(5(9)10)1-2-4(7)8/h9-10,19H,2-8,11-18H2,1H3;3H,1-2,6H2,(H,7,8)(H,9,10)/b10-9-; |
| InChIKey | ZZPYQQDQSOLOHY-KVVVOXFISA-N |
| XLogP | 5.28 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|