C30H56O3 — CID 18981419
(13E,16E)-4-butyl-26-hydroxyhexacosa-13,16-dienoic acid (PubChem CID 18981419) has the molecular formula C30H56O3 and a molecular weight of 464.78 g/mol. Its IUPAC name is (13E,16E)-4-butyl-26-hydroxyhexacosa-13,16-dienoic acid.
| Compound Name | (13E,16E)-4-butyl-26-hydroxyhexacosa-13,16-dienoic acid |
|---|---|
| PubChem CID | 18981419 |
| Molecular Formula | C30H56O3 |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 464.42 |
| IUPAC Name | (13E,16E)-4-butyl-26-hydroxyhexacosa-13,16-dienoic acid |
| SMILES | CCCCC(CCCCCCCC/C=C/C/C=C/CCCCCCCCCO)CCC(=O)O |
| InChI | InChI=1S/C30H56O3/c1-2-3-24-29(26-27-30(32)33)25-22-20-18-16-14-12-10-8-6-4-5-7-9-11-13-15-17-19-21-23-28-31/h5-8,29,31H,2-4,9-28H2,1H3,(H,32,33)/b7-5+,8-6+ |
| InChIKey | IBGKMLWRQDOBPL-KQQUZDAGSA-N |
| XLogP | 9.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|