C24H38O3 — CID 134916944
(5E,8E,11Z,14E,17E)-24-hydroxytetracosa-5,8,11,14,17-pentaenoic acid (PubChem CID 134916944) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (5E,8E,11Z,14E,17E)-24-hydroxytetracosa-5,8,11,14,17-pentaenoic acid.
| Compound Name | (5E,8E,11Z,14E,17E)-24-hydroxytetracosa-5,8,11,14,17-pentaenoic acid |
|---|---|
| PubChem CID | 134916944 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (5E,8E,11Z,14E,17E)-24-hydroxytetracosa-5,8,11,14,17-pentaenoic acid |
| SMILES | O=C(O)CCC/C=C/C/C=C/C/C=C\C/C=C/C/C=C/CCCCCCO |
| InChI | InChI=1S/C24H38O3/c25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24(26)27/h2-5,8-11,14,16,25H,1,6-7,12-13,15,17-23H2,(H,26,27)/b4-2-,5-3+,10-8+,11-9+,16-14+ |
| InChIKey | BVOFOOHGBBWIBV-CFWUJQMYSA-N |
| XLogP | 6.53 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|