14-hydroxytetradec-5-enoic acid

C14H26O3 — CID 78383968

IUPAC14-hydroxytetradec-5-enoic acid
SMILESO=C(O)CCCC=CCCCCCCCCO
InChIInChI=1S/C14H26O3/c15-13-11-9-7-5-3-1-2-4-6-8-10-12-14(16)17/h4,6,15H,1-3,5,7-13H2,(H,16,17)
InChIKeyXVNKMDSYLQAATP-UHFFFAOYSA-N
MW242.36 g/mol
LogP3.52
Rot. Bonds12

About 14-hydroxytetradec-5-enoic acid

14-hydroxytetradec-5-enoic acid (PubChem CID 78383968) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 14-hydroxytetradec-5-enoic acid.

Molecular Properties

Compound Name14-hydroxytetradec-5-enoic acid
PubChem CID78383968
Molecular FormulaC14H26O3
Molecular Weight242.36 g/mol
Exact Mass242.19
IUPAC Name14-hydroxytetradec-5-enoic acid
SMILESO=C(O)CCCC=CCCCCCCCCO
InChIInChI=1S/C14H26O3/c15-13-11-9-7-5-3-1-2-4-6-8-10-12-14(16)17/h4,6,15H,1-3,5,7-13H2,(H,16,17)
InChIKeyXVNKMDSYLQAATP-UHFFFAOYSA-N
XLogP3.52
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds12
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.36
LogP ≤ 53.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 14-hydroxytetradec-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

20-hydroxyicosa-5,14-dienoic acid
CID 85146176
15-hydroxypentadec-10-enoic acid
CID 165358734
(Z)-32-hydroxydotriacont-23-enoic acid
CID 13377993
(5E,8E,11Z,14E,17E)-24-hydroxytetracosa-5,8,11,14,17-pentaenoic acid
CID 134916944
(5E,8E,11Z,14E,17E)-25-hydroxypentacosa-5,8,11,14,17-pentaenoic acid
CID 134916945
(14E,17E)-28-hydroxyoctacosa-14,17-dienoic acid
CID 18981442
(11E,14E)-22-hydroxydocosa-11,14-dienoic acid
CID 18981383
(Z)-dodec-5-enedioic acid
CID 86751837
hexadecanoic acid;(Z)-octadec-9-en-1-ol
CID 174574592
(Z)-docos-13-en-1-ol;tetradecanoic acid
CID 175083189
butane-1,4-diol;octadec-9-enoic acid
CID 57346584
(Z)-docos-13-en-1-ol;octadecanoic acid
CID 174497002

Frequently Asked Questions

What is the IUPAC name of 14-hydroxytetradec-5-enoic acid?
The IUPAC name of 14-hydroxytetradec-5-enoic acid (CID 78383968) is 14-hydroxytetradec-5-enoic acid.
What is the SMILES notation for 14-hydroxytetradec-5-enoic acid?
The canonical SMILES for 14-hydroxytetradec-5-enoic acid is O=C(O)CCCC=CCCCCCCCCO.
What is the InChIKey of 14-hydroxytetradec-5-enoic acid?
The InChIKey is XVNKMDSYLQAATP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c15-13-11-9-7-5-3-1-2-4-6-8-10-12-14(16)17/h4,6,15H,1-3,5,7-13H2,(H,16,17).
What are the key properties of 14-hydroxytetradec-5-enoic acid?
14-hydroxytetradec-5-enoic acid has a molecular weight of 242.36 g/mol, XLogP of 3.52, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 14-hydroxytetradec-5-enoic acid is sourced from PubChem (CID 78383968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).