About (Z)-dodec-5-enedioic acid
(Z)-dodec-5-enedioic acid (PubChem CID 86751837) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is (Z)-dodec-5-enedioic acid.
Molecular Properties
| Compound Name | (Z)-dodec-5-enedioic acid |
| PubChem CID | 86751837 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (Z)-dodec-5-enedioic acid |
| SMILES | O=C(O)CCC/C=C\CCCCCC(=O)O |
| InChI | InChI=1S/C12H20O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h1,3H,2,4-10H2,(H,13,14)(H,15,16)/b3-1- |
| InChIKey | OHCMUMNQAHNIEP-IWQZZHSRSA-N |
| XLogP | 2.83 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-dodec-5-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-dodec-5-enedioic acid?
The IUPAC name of (Z)-dodec-5-enedioic acid (CID 86751837) is (Z)-dodec-5-enedioic acid.
What is the SMILES notation for (Z)-dodec-5-enedioic acid?
The canonical SMILES for (Z)-dodec-5-enedioic acid is O=C(O)CCC/C=C\CCCCCC(=O)O.
What is the InChIKey of (Z)-dodec-5-enedioic acid?
The InChIKey is OHCMUMNQAHNIEP-IWQZZHSRSA-N. The full InChI is InChI=1S/C12H20O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h1,3H,2,4-10H2,(H,13,14)(H,15,16)/b3-1-.
What are the key properties of (Z)-dodec-5-enedioic acid?
(Z)-dodec-5-enedioic acid has a molecular weight of 228.29 g/mol, XLogP of 2.83, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-dodec-5-enedioic acid is sourced from PubChem (CID 86751837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).