About (E)-pentadec-4-enedioic acid
(E)-pentadec-4-enedioic acid (PubChem CID 156873655) has the molecular formula C15H26O4
and a molecular weight of 270.37 g/mol. Its IUPAC name is (E)-pentadec-4-enedioic acid.
Molecular Properties
| Compound Name | (E)-pentadec-4-enedioic acid |
| PubChem CID | 156873655 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (E)-pentadec-4-enedioic acid |
| SMILES | O=C(O)CC/C=C/CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C15H26O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h6,8H,1-5,7,9-13H2,(H,16,17)(H,18,19)/b8-6+ |
| InChIKey | ZFRYVDPJMPDFCK-SOFGYWHQSA-N |
| XLogP | 4.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-pentadec-4-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-pentadec-4-enedioic acid?
The IUPAC name of (E)-pentadec-4-enedioic acid (CID 156873655) is (E)-pentadec-4-enedioic acid.
What is the SMILES notation for (E)-pentadec-4-enedioic acid?
The canonical SMILES for (E)-pentadec-4-enedioic acid is O=C(O)CC/C=C/CCCCCCCCCC(=O)O.
What is the InChIKey of (E)-pentadec-4-enedioic acid?
The InChIKey is ZFRYVDPJMPDFCK-SOFGYWHQSA-N. The full InChI is InChI=1S/C15H26O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h6,8H,1-5,7,9-13H2,(H,16,17)(H,18,19)/b8-6+.
What are the key properties of (E)-pentadec-4-enedioic acid?
(E)-pentadec-4-enedioic acid has a molecular weight of 270.37 g/mol, XLogP of 4.00, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-pentadec-4-enedioic acid is sourced from PubChem (CID 156873655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).