C24H48O5 — CID 173033204
2-(hydroxymethyl)pentane-1,5-diol;octadec-9-enoic acid (PubChem CID 173033204) has the molecular formula C24H48O5 and a molecular weight of 416.64 g/mol. Its IUPAC name is 2-(hydroxymethyl)pentane-1,5-diol;octadec-9-enoic acid.
| Compound Name | 2-(hydroxymethyl)pentane-1,5-diol;octadec-9-enoic acid |
|---|---|
| PubChem CID | 173033204 |
| Molecular Formula | C24H48O5 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | 2-(hydroxymethyl)pentane-1,5-diol;octadec-9-enoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.OCCCC(CO)CO |
| InChI | InChI=1S/C18H34O2.C6H14O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;7-3-1-2-6(4-8)5-9/h9-10H,2-8,11-17H2,1H3,(H,19,20);6-9H,1-5H2 |
| InChIKey | TWQZAMSBQGVMIC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|