C23H46O4 — CID 173421300
2-methylbutane-1,4-diol;octadec-9-enoic acid (PubChem CID 173421300) has the molecular formula C23H46O4 and a molecular weight of 386.62 g/mol. Its IUPAC name is 2-methylbutane-1,4-diol;octadec-9-enoic acid.
| Compound Name | 2-methylbutane-1,4-diol;octadec-9-enoic acid |
|---|---|
| PubChem CID | 173421300 |
| Molecular Formula | C23H46O4 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | 2-methylbutane-1,4-diol;octadec-9-enoic acid |
| SMILES | CC(CO)CCO.CCCCCCCCC=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C5H12O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-5(4-7)2-3-6/h9-10H,2-8,11-17H2,1H3,(H,19,20);5-7H,2-4H2,1H3 |
| InChIKey | FHBXJIJMDRZJSW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|