About sodium;hexadec-9-enoic acid;hydride
sodium;hexadec-9-enoic acid;hydride (PubChem CID 172998914) has the molecular formula C16H31NaO2
and a molecular weight of 278.41 g/mol. Its IUPAC name is sodium;hexadec-9-enoic acid;hydride.
Molecular Properties
| Compound Name | sodium;hexadec-9-enoic acid;hydride |
| PubChem CID | 172998914 |
| Molecular Formula | C16H31NaO2 |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | sodium;hexadec-9-enoic acid;hydride |
| SMILES | CCCCCCC=CCCCCCCCC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C16H30O2.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;;/h7-8H,2-6,9-15H2,1H3,(H,17,18);;/q;+1;-1 |
| InChIKey | DFDHAZASMUVPBZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;hexadec-9-enoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hexadec-9-enoic acid;hydride?
The IUPAC name of sodium;hexadec-9-enoic acid;hydride (CID 172998914) is sodium;hexadec-9-enoic acid;hydride.
What is the SMILES notation for sodium;hexadec-9-enoic acid;hydride?
The canonical SMILES for sodium;hexadec-9-enoic acid;hydride is CCCCCCC=CCCCCCCCC(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hexadec-9-enoic acid;hydride?
The InChIKey is DFDHAZASMUVPBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;;/h7-8H,2-6,9-15H2,1H3,(H,17,18);;/q;+1;-1.
What are the key properties of sodium;hexadec-9-enoic acid;hydride?
sodium;hexadec-9-enoic acid;hydride has a molecular weight of 278.41 g/mol, XLogP of 2.44, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hexadec-9-enoic acid;hydride is sourced from PubChem (CID 172998914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).