potassium;hydride;(Z)-tetracos-15-enoic acid

C24H47KO2 — CID 174974374

IUPACpotassium;hydride;(Z)-tetracos-15-enoic acid
SMILESCCCCCCCC/C=C\CCCCCCCCCCCCCC(=O)O.[H-].[K+]
InChIInChI=1S/C24H46O2.K.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26;;/h9-10H,2-8,11-23H2,1H3,(H,25,26);;/q;+1;-1/b10-9-;;
InChIKeyJTQCQTRHEZMWFX-XXAVUKJNSA-N
MW406.74 g/mol
LogP5.57
Rot. Bonds21

About potassium;hydride;(Z)-tetracos-15-enoic acid

potassium;hydride;(Z)-tetracos-15-enoic acid (PubChem CID 174974374) has the molecular formula C24H47KO2 and a molecular weight of 406.74 g/mol. Its IUPAC name is potassium;hydride;(Z)-tetracos-15-enoic acid.

Molecular Properties

Compound Namepotassium;hydride;(Z)-tetracos-15-enoic acid
PubChem CID174974374
Molecular FormulaC24H47KO2
Molecular Weight406.74 g/mol
Exact Mass406.32
IUPAC Namepotassium;hydride;(Z)-tetracos-15-enoic acid
SMILESCCCCCCCC/C=C\CCCCCCCCCCCCCC(=O)O.[H-].[K+]
InChIInChI=1S/C24H46O2.K.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26;;/h9-10H,2-8,11-23H2,1H3,(H,25,26);;/q;+1;-1/b10-9-;;
InChIKeyJTQCQTRHEZMWFX-XXAVUKJNSA-N
XLogP5.57
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds21
Heavy Atoms27
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500406.74
LogP ≤ 55.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze potassium;hydride;(Z)-tetracos-15-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium;hydride;(Z)-tetracos-15-enoic acid?
The IUPAC name of potassium;hydride;(Z)-tetracos-15-enoic acid (CID 174974374) is potassium;hydride;(Z)-tetracos-15-enoic acid.
What is the SMILES notation for potassium;hydride;(Z)-tetracos-15-enoic acid?
The canonical SMILES for potassium;hydride;(Z)-tetracos-15-enoic acid is CCCCCCCC/C=C\CCCCCCCCCCCCCC(=O)O.[H-].[K+].
What is the InChIKey of potassium;hydride;(Z)-tetracos-15-enoic acid?
The InChIKey is JTQCQTRHEZMWFX-XXAVUKJNSA-N. The full InChI is InChI=1S/C24H46O2.K.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26;;/h9-10H,2-8,11-23H2,1H3,(H,25,26);;/q;+1;-1/b10-9-;;.
What are the key properties of potassium;hydride;(Z)-tetracos-15-enoic acid?
potassium;hydride;(Z)-tetracos-15-enoic acid has a molecular weight of 406.74 g/mol, XLogP of 5.57, 21 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;(Z)-tetracos-15-enoic acid is sourced from PubChem (CID 174974374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).