C21H38O3 — CID 18981404
(10E,13E)-20-hydroxy-4-methylicosa-10,13-dienoic acid (PubChem CID 18981404) has the molecular formula C21H38O3 and a molecular weight of 338.53 g/mol. Its IUPAC name is (10E,13E)-20-hydroxy-4-methylicosa-10,13-dienoic acid.
| Compound Name | (10E,13E)-20-hydroxy-4-methylicosa-10,13-dienoic acid |
|---|---|
| PubChem CID | 18981404 |
| Molecular Formula | C21H38O3 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | (10E,13E)-20-hydroxy-4-methylicosa-10,13-dienoic acid |
| SMILES | CC(CCCCC/C=C/C/C=C/CCCCCCO)CCC(=O)O |
| InChI | InChI=1S/C21H38O3/c1-20(17-18-21(23)24)16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-19-22/h3-6,20,22H,2,7-19H2,1H3,(H,23,24)/b5-3+,6-4+ |
| InChIKey | MFYROWCABLBAMA-GGWOSOGESA-N |
| XLogP | 5.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|