About acetic acid;hexadec-10-en-1-ol
acetic acid;hexadec-10-en-1-ol (PubChem CID 71444791) has the molecular formula C18H36O3
and a molecular weight of 300.48 g/mol. Its IUPAC name is acetic acid;hexadec-10-en-1-ol.
Molecular Properties
| Compound Name | acetic acid;hexadec-10-en-1-ol |
| PubChem CID | 71444791 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | acetic acid;hexadec-10-en-1-ol |
| SMILES | CC(=O)O.CCCCCC=CCCCCCCCCCO |
| InChI | InChI=1S/C16H32O.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17;1-2(3)4/h6-7,17H,2-5,8-16H2,1H3;1H3,(H,3,4) |
| InChIKey | BKWAKIYRJHHRFD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;hexadec-10-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;hexadec-10-en-1-ol?
The IUPAC name of acetic acid;hexadec-10-en-1-ol (CID 71444791) is acetic acid;hexadec-10-en-1-ol.
What is the SMILES notation for acetic acid;hexadec-10-en-1-ol?
The canonical SMILES for acetic acid;hexadec-10-en-1-ol is CC(=O)O.CCCCCC=CCCCCCCCCCO.
What is the InChIKey of acetic acid;hexadec-10-en-1-ol?
The InChIKey is BKWAKIYRJHHRFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17;1-2(3)4/h6-7,17H,2-5,8-16H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;hexadec-10-en-1-ol?
acetic acid;hexadec-10-en-1-ol has a molecular weight of 300.48 g/mol, XLogP of 5.33, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;hexadec-10-en-1-ol is sourced from PubChem (CID 71444791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).