About acetic acid;(Z)-tetradec-8-en-1-ol
acetic acid;(Z)-tetradec-8-en-1-ol (PubChem CID 175504388) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is acetic acid;(Z)-tetradec-8-en-1-ol.
Molecular Properties
| Compound Name | acetic acid;(Z)-tetradec-8-en-1-ol |
| PubChem CID | 175504388 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | acetic acid;(Z)-tetradec-8-en-1-ol |
| SMILES | CC(=O)O.CCCCC/C=C\CCCCCCCO |
| InChI | InChI=1S/C14H28O.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15;1-2(3)4/h6-7,15H,2-5,8-14H2,1H3;1H3,(H,3,4)/b7-6-; |
| InChIKey | FKLOJMCZYAUMLY-NAFXZHHSSA-N |
| XLogP | 4.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(Z)-tetradec-8-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(Z)-tetradec-8-en-1-ol?
The IUPAC name of acetic acid;(Z)-tetradec-8-en-1-ol (CID 175504388) is acetic acid;(Z)-tetradec-8-en-1-ol.
What is the SMILES notation for acetic acid;(Z)-tetradec-8-en-1-ol?
The canonical SMILES for acetic acid;(Z)-tetradec-8-en-1-ol is CC(=O)O.CCCCC/C=C\CCCCCCCO.
What is the InChIKey of acetic acid;(Z)-tetradec-8-en-1-ol?
The InChIKey is FKLOJMCZYAUMLY-NAFXZHHSSA-N. The full InChI is InChI=1S/C14H28O.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15;1-2(3)4/h6-7,15H,2-5,8-14H2,1H3;1H3,(H,3,4)/b7-6-;.
What are the key properties of acetic acid;(Z)-tetradec-8-en-1-ol?
acetic acid;(Z)-tetradec-8-en-1-ol has a molecular weight of 272.43 g/mol, XLogP of 4.55, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(Z)-tetradec-8-en-1-ol is sourced from PubChem (CID 175504388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).