About amino (Z)-octadec-9-enoate
amino (Z)-octadec-9-enoate (PubChem CID 87082504) has the molecular formula C18H35NO2
and a molecular weight of 297.48 g/mol. Its IUPAC name is amino (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | amino (Z)-octadec-9-enoate |
| PubChem CID | 87082504 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | amino (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)ON |
| InChI | InChI=1S/C18H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)21-19/h9-10H,2-8,11-17,19H2,1H3/b10-9- |
| InChIKey | SFEWMGIPBBLNJX-KTKRTIGZSA-N |
| XLogP | 5.44 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino (Z)-octadec-9-enoate?
The IUPAC name of amino (Z)-octadec-9-enoate (CID 87082504) is amino (Z)-octadec-9-enoate.
What is the SMILES notation for amino (Z)-octadec-9-enoate?
The canonical SMILES for amino (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)ON.
What is the InChIKey of amino (Z)-octadec-9-enoate?
The InChIKey is SFEWMGIPBBLNJX-KTKRTIGZSA-N. The full InChI is InChI=1S/C18H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)21-19/h9-10H,2-8,11-17,19H2,1H3/b10-9-.
What are the key properties of amino (Z)-octadec-9-enoate?
amino (Z)-octadec-9-enoate has a molecular weight of 297.48 g/mol, XLogP of 5.44, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino (Z)-octadec-9-enoate is sourced from PubChem (CID 87082504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).