C21H39O5PS — CID 53358655
(2-hydroxy-2-oxo-1,3,2λ5-oxathiaphospholan-5-yl)methyl (Z)-octadec-9-enoate (PubChem CID 53358655) has the molecular formula C21H39O5PS and a molecular weight of 434.58 g/mol. Its IUPAC name is (2-hydroxy-2-oxo-1,3,2λ5-oxathiaphospholan-5-yl)methyl (Z)-octadec-9-enoate.
| Compound Name | (2-hydroxy-2-oxo-1,3,2λ5-oxathiaphospholan-5-yl)methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 53358655 |
| Molecular Formula | C21H39O5PS |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (2-hydroxy-2-oxo-1,3,2λ5-oxathiaphospholan-5-yl)methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC1CSP(=O)(O)O1 |
| InChI | InChI=1S/C21H39O5PS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(22)25-18-20-19-28-27(23,24)26-20/h9-10,20H,2-8,11-19H2,1H3,(H,23,24)/b10-9- |
| InChIKey | DJFRFWMVQJONFI-KTKRTIGZSA-N |
| XLogP | 6.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|