About 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate
2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate (PubChem CID 174667937) has the molecular formula C29H54O5
and a molecular weight of 482.75 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate |
| PubChem CID | 174667937 |
| Molecular Formula | C29H54O5 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.40 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate |
| SMILES | C(OCC1CO1)C1CO1.CCCCCCCC/C=C\CCCCCCCC(=O)OCCCCC |
| InChI | InChI=1S/C23H44O2.C6H10O3/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-21-23(24)25-22-20-6-4-2;1(5-3-8-5)7-2-6-4-9-6/h12-13H,3-11,14-22H2,1-2H3;5-6H,1-4H2/b13-12-; |
| InChIKey | LGHGDRWCFPNJRV-USGGBSEESA-N |
| XLogP | 7.56 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate (CID 174667937) is 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate is C(OCC1CO1)C1CO1.CCCCCCCC/C=C\CCCCCCCC(=O)OCCCCC.
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate?
The InChIKey is LGHGDRWCFPNJRV-USGGBSEESA-N. The full InChI is InChI=1S/C23H44O2.C6H10O3/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-21-23(24)25-22-20-6-4-2;1(5-3-8-5)7-2-6-4-9-6/h12-13H,3-11,14-22H2,1-2H3;5-6H,1-4H2/b13-12-;.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate?
2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate has a molecular weight of 482.75 g/mol, XLogP of 7.56, 23 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;pentyl (Z)-octadec-9-enoate is sourced from PubChem (CID 174667937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).