C23H40O6 — CID 141182457
[(3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 141182457) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is [(3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 141182457 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | [(3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC1OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H40O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(25)29-23-22(27)21(26)19(24)18-28-23/h6-7,9-10,19,21-24,26-27H,2-5,8,11-18H2,1H3/b7-6-,10-9-/t19-,21-,22+,23?/m1/s1 |
| InChIKey | CETJCAVHXCTDSZ-KSFBZLCMSA-N |
| XLogP | 3.78 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|