C48H81NO7 — CID 166042503
[(4S,5R)-5-[[2-(1-methylpyrrolidin-3-yl)acetyl]oxymethyl]-4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 166042503) has the molecular formula C48H81NO7 and a molecular weight of 784.18 g/mol. Its IUPAC name is [(4S,5R)-5-[[2-(1-methylpyrrolidin-3-yl)acetyl]oxymethyl]-4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(4S,5R)-5-[[2-(1-methylpyrrolidin-3-yl)acetyl]oxymethyl]-4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 166042503 |
| Molecular Formula | C48H81NO7 |
| Molecular Weight | 784.18 g/mol |
| Exact Mass | 783.60 |
| IUPAC Name | [(4S,5R)-5-[[2-(1-methylpyrrolidin-3-yl)acetyl]oxymethyl]-4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC1CO[C@H](COC(=O)CC2CCN(C)C2)[C@@H]1OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C48H81NO7/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-45(50)55-44-41-53-43(40-54-47(52)38-42-36-37-49(3)39-42)48(44)56-46(51)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,42-44,48H,4-11,16-17,22-41H2,1-3H3/b14-12-,15-13-,20-18-,21-19-/t42?,43-,44?,48+/m1/s1 |
| InChIKey | WGWFYGDEXRJNCC-XPJRJCJXSA-N |
| XLogP | 11.72 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.18 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|