C66H111NO9 — CID 166042516
[(2R)-2-[(3R,4S)-3,4-bis[[(9Z,12Z)-octadeca-9,12-dienoyl]oxy]oxolan-2-yl]-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl] 1-methylpyrrolidine-3-carboxylate (PubChem CID 166042516) has the molecular formula C66H111NO9 and a molecular weight of 1062.61 g/mol. Its IUPAC name is [(2R)-2-[(3R,4S)-3,4-bis[[(9Z,12Z)-octadeca-9,12-dienoyl]oxy]oxolan-2-yl]-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl] 1-methylpyrrolidine-3-carboxylate.
| Compound Name | [(2R)-2-[(3R,4S)-3,4-bis[[(9Z,12Z)-octadeca-9,12-dienoyl]oxy]oxolan-2-yl]-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl] 1-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 166042516 |
| Molecular Formula | C66H111NO9 |
| Molecular Weight | 1062.61 g/mol |
| Exact Mass | 1061.83 |
| IUPAC Name | [(2R)-2-[(3R,4S)-3,4-bis[[(9Z,12Z)-octadeca-9,12-dienoyl]oxy]oxolan-2-yl]-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl] 1-methylpyrrolidine-3-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@H]1COC([C@@H](COC(=O)C2CCN(C)C2)OC(=O)CCCCCCC/C=C\C/C=C\CCCCC)[C@@H]1OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C66H111NO9/c1-5-8-11-14-17-20-23-26-29-32-35-38-41-44-47-50-61(68)74-59(57-73-66(71)58-53-54-67(4)55-58)64-65(76-63(70)52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-3)60(56-72-64)75-62(69)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-2/h17-22,26-31,58-60,64-65H,5-16,23-25,32-57H2,1-4H3/b20-17-,21-18-,22-19-,29-26-,30-27-,31-28-/t58?,59-,60+,64?,65-/m1/s1 |
| InChIKey | RJPUNQOSBCJEGQ-DRSBVDOPSA-N |
| XLogP | 17.06 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1062.61 |
| LogP ≤ 5 | 17.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|