C44H81NO2 — CID 58069677
[(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl] 1-methylpiperidine-4-carboxylate (PubChem CID 58069677) has the molecular formula C44H81NO2 and a molecular weight of 656.14 g/mol. Its IUPAC name is [(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl] 1-methylpiperidine-4-carboxylate.
| Compound Name | [(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl] 1-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58069677 |
| Molecular Formula | C44H81NO2 |
| Molecular Weight | 656.14 g/mol |
| Exact Mass | 655.63 |
| IUPAC Name | [(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl] 1-methylpiperidine-4-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\CCCCCCCC)OC(=O)C1CCN(C)CC1 |
| InChI | InChI=1S/C44H81NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43(47-44(46)42-38-40-45(3)41-39-42)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12,14,18-21,42-43H,4-11,13,15-17,22-41H2,1-3H3/b14-12-,20-18-,21-19- |
| InChIKey | KITCAAHTBBYOAZ-ATEMJZPOSA-N |
| XLogP | 13.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.14 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|