C48H87NO3 — CID 146502964
[(14Z,17Z)-5-hydroxy-5-octadeca-9,12-dienyltricosa-14,17-dienyl] 1-methylpiperidine-4-carboxylate (PubChem CID 146502964) has the molecular formula C48H87NO3 and a molecular weight of 726.23 g/mol. Its IUPAC name is [(14Z,17Z)-5-hydroxy-5-octadeca-9,12-dienyltricosa-14,17-dienyl] 1-methylpiperidine-4-carboxylate.
| Compound Name | [(14Z,17Z)-5-hydroxy-5-octadeca-9,12-dienyltricosa-14,17-dienyl] 1-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 146502964 |
| Molecular Formula | C48H87NO3 |
| Molecular Weight | 726.23 g/mol |
| Exact Mass | 725.67 |
| IUPAC Name | [(14Z,17Z)-5-hydroxy-5-octadeca-9,12-dienyltricosa-14,17-dienyl] 1-methylpiperidine-4-carboxylate |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(O)(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCOC(=O)C1CCN(C)CC1 |
| InChI | InChI=1S/C48H87NO3/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-40-48(51,42-36-37-45-52-47(50)46-38-43-49(3)44-39-46)41-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,46,51H,4-11,16-17,22-45H2,1-3H3/b14-12-,15-13?,20-18-,21-19? |
| InChIKey | XQPJKWQTUYELQV-PLFGDIFBSA-N |
| XLogP | 14.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.23 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|