C47H85NO3 — CID 142497069
[(14Z,17Z)-5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienyl]tricosa-14,17-dienyl] 2-pyrrolidin-1-ylacetate (PubChem CID 142497069) has the molecular formula C47H85NO3 and a molecular weight of 712.20 g/mol. Its IUPAC name is [(14Z,17Z)-5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienyl]tricosa-14,17-dienyl] 2-pyrrolidin-1-ylacetate.
| Compound Name | [(14Z,17Z)-5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienyl]tricosa-14,17-dienyl] 2-pyrrolidin-1-ylacetate |
|---|---|
| PubChem CID | 142497069 |
| Molecular Formula | C47H85NO3 |
| Molecular Weight | 712.20 g/mol |
| Exact Mass | 711.65 |
| IUPAC Name | [(14Z,17Z)-5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienyl]tricosa-14,17-dienyl] 2-pyrrolidin-1-ylacetate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCOC(=O)CN1CCCC1 |
| InChI | InChI=1S/C47H85NO3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39-47(50,41-35-38-44-51-46(49)45-48-42-36-37-43-48)40-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,50H,3-10,15-16,21-45H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | NZFIHOXBQXUGRP-MAZCIEHSSA-N |
| XLogP | 13.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.20 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|