C46H85NO — CID 146479021
(6Z,9Z,28Z,31Z)-19-(4-piperidin-1-ylbutyl)heptatriaconta-6,9,28,31-tetraen-19-ol (PubChem CID 146479021) has the molecular formula C46H85NO and a molecular weight of 668.19 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-19-(4-piperidin-1-ylbutyl)heptatriaconta-6,9,28,31-tetraen-19-ol.
| Compound Name | (6Z,9Z,28Z,31Z)-19-(4-piperidin-1-ylbutyl)heptatriaconta-6,9,28,31-tetraen-19-ol |
|---|---|
| PubChem CID | 146479021 |
| Molecular Formula | C46H85NO |
| Molecular Weight | 668.19 g/mol |
| Exact Mass | 667.66 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-19-(4-piperidin-1-ylbutyl)heptatriaconta-6,9,28,31-tetraen-19-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCN1CCCCC1 |
| InChI | InChI=1S/C46H85NO/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-34-40-46(48,42-36-39-45-47-43-37-33-38-44-47)41-35-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,48H,3-10,15-16,21-45H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | SIDOSYJWADFQKW-MAZCIEHSSA-N |
| XLogP | 14.78 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.19 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|