C41H77NO — CID 153487300
(6Z,9Z,28Z,31Z)-19-(4-aminobutyl)heptatriaconta-6,9,28,31-tetraen-19-ol (PubChem CID 153487300) has the molecular formula C41H77NO and a molecular weight of 600.07 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-19-(4-aminobutyl)heptatriaconta-6,9,28,31-tetraen-19-ol.
| Compound Name | (6Z,9Z,28Z,31Z)-19-(4-aminobutyl)heptatriaconta-6,9,28,31-tetraen-19-ol |
|---|---|
| PubChem CID | 153487300 |
| Molecular Formula | C41H77NO |
| Molecular Weight | 600.07 g/mol |
| Exact Mass | 599.60 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-19-(4-aminobutyl)heptatriaconta-6,9,28,31-tetraen-19-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)(CCCCN)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C41H77NO/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-41(43,39-35-36-40-42)38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,43H,3-10,15-16,21-40,42H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | ZUCLUEKYKCMVIR-MAZCIEHSSA-N |
| XLogP | 13.25 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.07 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|