C48H89NO5 — CID 166042480
[(2R,3R,4S)-3,4-bis[(Z)-octadec-9-enoxy]oxolan-2-yl]methyl 1-methylpiperidine-4-carboxylate (PubChem CID 166042480) has the molecular formula C48H89NO5 and a molecular weight of 760.24 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-bis[(Z)-octadec-9-enoxy]oxolan-2-yl]methyl 1-methylpiperidine-4-carboxylate.
| Compound Name | [(2R,3R,4S)-3,4-bis[(Z)-octadec-9-enoxy]oxolan-2-yl]methyl 1-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 166042480 |
| Molecular Formula | C48H89NO5 |
| Molecular Weight | 760.24 g/mol |
| Exact Mass | 759.67 |
| IUPAC Name | [(2R,3R,4S)-3,4-bis[(Z)-octadec-9-enoxy]oxolan-2-yl]methyl 1-methylpiperidine-4-carboxylate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCO[C@@H]1[C@@H](OCCCCCCCC/C=C\CCCCCCCC)CO[C@@H]1COC(=O)C1CCN(C)CC1 |
| InChI | InChI=1S/C48H89NO5/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-40-51-45-42-53-46(43-54-48(50)44-36-38-49(3)39-37-44)47(45)52-41-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,44-47H,4-17,22-43H2,1-3H3/b20-18-,21-19-/t45-,46+,47+/m0/s1 |
| InChIKey | ICUMVBPLYOMPKB-RLJKISOASA-N |
| XLogP | 13.12 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.24 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|