C48H82N2O7 — CID 166042598
[(3S,4S)-5-[[2-(4-methylpiperazin-1-yl)acetyl]oxymethyl]-4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 166042598) has the molecular formula C48H82N2O7 and a molecular weight of 799.19 g/mol. Its IUPAC name is [(3S,4S)-5-[[2-(4-methylpiperazin-1-yl)acetyl]oxymethyl]-4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(3S,4S)-5-[[2-(4-methylpiperazin-1-yl)acetyl]oxymethyl]-4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 166042598 |
| Molecular Formula | C48H82N2O7 |
| Molecular Weight | 799.19 g/mol |
| Exact Mass | 798.61 |
| IUPAC Name | [(3S,4S)-5-[[2-(4-methylpiperazin-1-yl)acetyl]oxymethyl]-4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@H]1COC(COC(=O)CN2CCN(C)CC2)[C@@H]1OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C48H82N2O7/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-45(51)56-44-42-54-43(41-55-47(53)40-50-38-36-49(3)37-39-50)48(44)57-46(52)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,43-44,48H,4-11,16-17,22-42H2,1-3H3/b14-12-,15-13-,20-18-,21-19-/t43?,44-,48-/m0/s1 |
| InChIKey | DJIGTMANKUPLMF-GTOUNCJNSA-N |
| XLogP | 10.63 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.19 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|