C51H93NO4 — CID 166495472
[3-[2-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]oxy-2-oxoethyl]cyclopentyl] 1-methylpiperidine-4-carboxylate (PubChem CID 166495472) has the molecular formula C51H93NO4 and a molecular weight of 784.31 g/mol. Its IUPAC name is [3-[2-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]oxy-2-oxoethyl]cyclopentyl] 1-methylpiperidine-4-carboxylate.
| Compound Name | [3-[2-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]oxy-2-oxoethyl]cyclopentyl] 1-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 166495472 |
| Molecular Formula | C51H93NO4 |
| Molecular Weight | 784.31 g/mol |
| Exact Mass | 783.71 |
| IUPAC Name | [3-[2-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]oxy-2-oxoethyl]cyclopentyl] 1-methylpiperidine-4-carboxylate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(CCCCCCCC/C=C\CCCCCCCC)OC(=O)CC1CCC(OC(=O)C2CCN(C)CC2)C1 |
| InChI | InChI=1S/C51H93NO4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-48(37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2)55-50(53)45-46-38-39-49(44-46)56-51(54)47-40-42-52(3)43-41-47/h18-21,46-49H,4-17,22-45H2,1-3H3/b20-18-,21-19- |
| InChIKey | FICJZBLUJSLCEP-AUYXYSRISA-N |
| XLogP | 15.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.31 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|