C22H42O2S — CID 22555016
[(E)-heptadec-4-en-9-yl] 3-methyl-3-sulfanylbutanoate (PubChem CID 22555016) has the molecular formula C22H42O2S and a molecular weight of 370.64 g/mol. Its IUPAC name is [(E)-heptadec-4-en-9-yl] 3-methyl-3-sulfanylbutanoate.
| Compound Name | [(E)-heptadec-4-en-9-yl] 3-methyl-3-sulfanylbutanoate |
|---|---|
| PubChem CID | 22555016 |
| Molecular Formula | C22H42O2S |
| Molecular Weight | 370.64 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | [(E)-heptadec-4-en-9-yl] 3-methyl-3-sulfanylbutanoate |
| SMILES | CCC/C=C/CCCC(CCCCCCCC)OC(=O)CC(C)(C)S |
| InChI | InChI=1S/C22H42O2S/c1-5-7-9-11-13-15-17-20(18-16-14-12-10-8-6-2)24-21(23)19-22(3,4)25/h9,11,20,25H,5-8,10,12-19H2,1-4H3/b11-9+ |
| InChIKey | NKMFCMYFLCGOLR-PKNBQFBNSA-N |
| XLogP | 7.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|