C56H101NO4 — CID 166495409
[3-[2-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]oxy-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,3-dimethylpyrrolidine-3-carboxylate (PubChem CID 166495409) has the molecular formula C56H101NO4 and a molecular weight of 852.43 g/mol. Its IUPAC name is [3-[2-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]oxy-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,3-dimethylpyrrolidine-3-carboxylate.
| Compound Name | [3-[2-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]oxy-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,3-dimethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 166495409 |
| Molecular Formula | C56H101NO4 |
| Molecular Weight | 852.43 g/mol |
| Exact Mass | 851.77 |
| IUPAC Name | [3-[2-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]oxy-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,3-dimethylpyrrolidine-3-carboxylate |
| SMILES | CC/C=C\CC1C(CC(=O)OC(CCCCCCCC/C=C\CCCCCCCC)CCCCCCCC/C=C\CCCCCCCC)CCC1OC(=O)C1(C)CCN(C)C1 |
| InChI | InChI=1S/C56H101NO4/c1-6-9-12-14-16-18-20-22-24-26-28-30-32-34-36-39-41-51(42-40-37-35-33-31-29-27-25-23-21-19-17-15-13-10-7-2)60-54(58)48-50-44-45-53(52(50)43-38-11-8-3)61-55(59)56(4)46-47-57(5)49-56/h11,22-25,38,50-53H,6-10,12-21,26-37,39-49H2,1-5H3/b24-22-,25-23-,38-11- |
| InChIKey | MEMFQPKXWPMQLO-FSWVQMSLSA-N |
| XLogP | 16.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.43 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|