C49H87NO10 — CID 166495383
1-[2-[3-[4-(dimethylamino)butanoyloxy]-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]oxyundecan-3-yl 7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoate (PubChem CID 166495383) has the molecular formula C49H87NO10 and a molecular weight of 850.23 g/mol. Its IUPAC name is 1-[2-[3-[4-(dimethylamino)butanoyloxy]-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]oxyundecan-3-yl 7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoate.
| Compound Name | 1-[2-[3-[4-(dimethylamino)butanoyloxy]-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]oxyundecan-3-yl 7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoate |
|---|---|
| PubChem CID | 166495383 |
| Molecular Formula | C49H87NO10 |
| Molecular Weight | 850.23 g/mol |
| Exact Mass | 849.63 |
| IUPAC Name | 1-[2-[3-[4-(dimethylamino)butanoyloxy]-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]oxyundecan-3-yl 7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoate |
| SMILES | CC/C=C\CC1C(CC(=O)OCCC(CCCCCCCC)OC(=O)CCCCC(COC(=O)CCCCC)COC(=O)CCCCC)CCC1OC(=O)CCCN(C)C |
| InChI | InChI=1S/C49H87NO10/c1-7-11-15-16-17-21-26-42(34-36-56-49(55)37-41-32-33-44(43(41)27-18-12-8-2)60-48(54)31-24-35-50(5)6)59-47(53)30-23-22-25-40(38-57-45(51)28-19-13-9-3)39-58-46(52)29-20-14-10-4/h12,18,40-44H,7-11,13-17,19-39H2,1-6H3/b18-12- |
| InChIKey | BEHWBYIOZQUVCM-PDGQHHTCSA-N |
| XLogP | 11.03 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.23 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|