C50H87NO10 — CID 166495500
[3-[2-[3-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyundecoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1-methylpiperidine-4-carboxylate (PubChem CID 166495500) has the molecular formula C50H87NO10 and a molecular weight of 862.24 g/mol. Its IUPAC name is [3-[2-[3-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyundecoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1-methylpiperidine-4-carboxylate.
| Compound Name | [3-[2-[3-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyundecoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 166495500 |
| Molecular Formula | C50H87NO10 |
| Molecular Weight | 862.24 g/mol |
| Exact Mass | 861.63 |
| IUPAC Name | [3-[2-[3-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyundecoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1-methylpiperidine-4-carboxylate |
| SMILES | CC/C=C\CC1C(CC(=O)OCCC(CCCCCCCC)OC(=O)CCCCC(COC(=O)CCCCC)COC(=O)CCCCC)CCC1OC(=O)C1CCN(C)CC1 |
| InChI | InChI=1S/C50H87NO10/c1-6-10-14-15-16-20-24-43(60-48(54)28-22-21-23-40(38-58-46(52)26-18-12-8-3)39-59-47(53)27-19-13-9-4)33-36-57-49(55)37-42-29-30-45(44(42)25-17-11-7-2)61-50(56)41-31-34-51(5)35-32-41/h11,17,40-45H,6-10,12-16,18-39H2,1-5H3/b17-11- |
| InChIKey | CBAZZWZRZOTIEP-BOPFTXTBSA-N |
| XLogP | 11.03 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.24 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|