C60H103NO10 — CID 166495584
[3-[2-[(11Z,14Z)-2-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyicosa-11,14-dienoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,4-dimethylpiperidine-4-carboxylate (PubChem CID 166495584) has the molecular formula C60H103NO10 and a molecular weight of 998.48 g/mol. Its IUPAC name is [3-[2-[(11Z,14Z)-2-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyicosa-11,14-dienoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,4-dimethylpiperidine-4-carboxylate.
| Compound Name | [3-[2-[(11Z,14Z)-2-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyicosa-11,14-dienoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,4-dimethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 166495584 |
| Molecular Formula | C60H103NO10 |
| Molecular Weight | 998.48 g/mol |
| Exact Mass | 997.76 |
| IUPAC Name | [3-[2-[(11Z,14Z)-2-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyicosa-11,14-dienoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,4-dimethylpiperidine-4-carboxylate |
| SMILES | CC/C=C\CC1C(CC(=O)OCC(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)CCCCC(COC(=O)CCCCC)COC(=O)CCCCC)CCC1OC(=O)C1(C)CCN(C)CC1 |
| InChI | InChI=1S/C60H103NO10/c1-7-11-15-16-17-18-19-20-21-22-23-24-25-26-27-31-35-52(70-57(64)39-33-32-34-50(47-67-55(62)37-29-13-9-3)48-68-56(63)38-30-14-10-4)49-69-58(65)46-51-40-41-54(53(51)36-28-12-8-2)71-59(66)60(5)42-44-61(6)45-43-60/h12,17-18,20-21,28,50-54H,7-11,13-16,19,22-27,29-49H2,1-6H3/b18-17-,21-20-,28-12- |
| InChIKey | KJUAJPKRZKZLEW-DVIQQRPFSA-N |
| XLogP | 14.48 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 998.48 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|