C59H103NO6 — CID 166495392
[3-[2-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,3-dimethylpiperidine-3-carboxylate (PubChem CID 166495392) has the molecular formula C59H103NO6 and a molecular weight of 922.47 g/mol. Its IUPAC name is [3-[2-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,3-dimethylpiperidine-3-carboxylate.
| Compound Name | [3-[2-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,3-dimethylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 166495392 |
| Molecular Formula | C59H103NO6 |
| Molecular Weight | 922.47 g/mol |
| Exact Mass | 921.78 |
| IUPAC Name | [3-[2-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 1,3-dimethylpiperidine-3-carboxylate |
| SMILES | CC/C=C\CC1C(CC(=O)OCC(COCCCCCCCC/C=C\C/C=C\CCCCC)OCCCCCCCC/C=C\C/C=C\CCCCC)CCC1OC(=O)C1(C)CCCN(C)C1 |
| InChI | InChI=1S/C59H103NO6/c1-6-9-12-14-16-18-20-22-24-26-28-30-32-34-36-39-47-63-50-54(64-48-40-37-35-33-31-29-27-25-23-21-19-17-15-13-10-7-2)51-65-57(61)49-53-43-44-56(55(53)42-38-11-8-3)66-58(62)59(4)45-41-46-60(5)52-59/h11,16-19,22-25,38,53-56H,6-10,12-15,20-21,26-37,39-52H2,1-5H3/b18-16-,19-17-,24-22-,25-23-,38-11- |
| InChIKey | CTNZGYXCSSODHV-WELQKYSFSA-N |
| XLogP | 15.97 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.47 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|