C58H102N2O6 — CID 166495658
2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl 2-[3-[2-(4-methylpiperazin-1-yl)acetyl]oxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetate (PubChem CID 166495658) has the molecular formula C58H102N2O6 and a molecular weight of 923.46 g/mol. Its IUPAC name is 2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl 2-[3-[2-(4-methylpiperazin-1-yl)acetyl]oxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetate.
| Compound Name | 2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl 2-[3-[2-(4-methylpiperazin-1-yl)acetyl]oxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 166495658 |
| Molecular Formula | C58H102N2O6 |
| Molecular Weight | 923.46 g/mol |
| Exact Mass | 922.77 |
| IUPAC Name | 2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl 2-[3-[2-(4-methylpiperazin-1-yl)acetyl]oxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
| SMILES | CC/C=C\CC1C(CC(=O)OCC(COCCCCCCCC/C=C\C/C=C\CCCCC)OCCCCCCCC/C=C\C/C=C\CCCCC)CCC1OC(=O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C58H102N2O6/c1-5-8-11-13-15-17-19-21-23-25-27-29-31-33-35-38-47-63-51-54(64-48-39-36-34-32-30-28-26-24-22-20-18-16-14-12-9-6-2)52-65-57(61)49-53-41-42-56(55(53)40-37-10-7-3)66-58(62)50-60-45-43-59(4)44-46-60/h10,15-18,21-24,37,53-56H,5-9,11-14,19-20,25-36,38-52H2,1-4H3/b17-15-,18-16-,23-21-,24-22-,37-10- |
| InChIKey | MKQUFUODYQMETD-QGCVGZIMSA-N |
| XLogP | 14.49 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.46 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|