C57H99NO6 — CID 167214201
[3-[2-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 3-methylpyrrolidine-3-carboxylate (PubChem CID 167214201) has the molecular formula C57H99NO6 and a molecular weight of 894.42 g/mol. Its IUPAC name is [3-[2-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 3-methylpyrrolidine-3-carboxylate.
| Compound Name | [3-[2-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 3-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 167214201 |
| Molecular Formula | C57H99NO6 |
| Molecular Weight | 894.42 g/mol |
| Exact Mass | 893.75 |
| IUPAC Name | [3-[2-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 3-methylpyrrolidine-3-carboxylate |
| SMILES | CC/C=C\CC1C(CC(=O)OCC(COCCCCCCCC/C=C\C/C=C\CCCCC)OCCCCCCCC/C=C\C/C=C\CCCCC)CCC1OC(=O)C1(C)CCNC1 |
| InChI | InChI=1S/C57H99NO6/c1-5-8-11-13-15-17-19-21-23-25-27-29-31-33-35-38-45-61-48-52(62-46-39-36-34-32-30-28-26-24-22-20-18-16-14-12-9-6-2)49-63-55(59)47-51-41-42-54(53(51)40-37-10-7-3)64-56(60)57(4)43-44-58-50-57/h10,15-18,21-24,37,51-54,58H,5-9,11-14,19-20,25-36,38-50H2,1-4H3/b17-15-,18-16-,23-21-,24-22-,37-10- |
| InChIKey | IWIVFHMQJJCIGT-QGCVGZIMSA-N |
| XLogP | 15.24 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.42 |
| LogP ≤ 5 | 15.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|