C56H101NO5 — CID 166495430
2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl 2-[3-[3-(dimethylamino)propoxy]-2-[(Z)-pent-2-enyl]cyclopentyl]acetate (PubChem CID 166495430) has the molecular formula C56H101NO5 and a molecular weight of 868.43 g/mol. Its IUPAC name is 2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl 2-[3-[3-(dimethylamino)propoxy]-2-[(Z)-pent-2-enyl]cyclopentyl]acetate.
| Compound Name | 2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl 2-[3-[3-(dimethylamino)propoxy]-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 166495430 |
| Molecular Formula | C56H101NO5 |
| Molecular Weight | 868.43 g/mol |
| Exact Mass | 867.77 |
| IUPAC Name | 2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl 2-[3-[3-(dimethylamino)propoxy]-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
| SMILES | CC/C=C\CC1C(CC(=O)OCC(COCCCCCCCC/C=C\C/C=C\CCCCC)OCCCCCCCC/C=C\C/C=C\CCCCC)CCC1OCCCN(C)C |
| InChI | InChI=1S/C56H101NO5/c1-6-9-12-14-16-18-20-22-24-26-28-30-32-34-36-39-46-59-50-53(60-47-40-37-35-33-31-29-27-25-23-21-19-17-15-13-10-7-2)51-62-56(58)49-52-43-44-55(54(52)42-38-11-8-3)61-48-41-45-57(4)5/h11,16-19,22-25,38,52-55H,6-10,12-15,20-21,26-37,39-51H2,1-5H3/b18-16-,19-17-,24-22-,25-23-,38-11- |
| InChIKey | HCKWBLFSOFNOGN-WELQKYSFSA-N |
| XLogP | 15.67 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.43 |
| LogP ≤ 5 | 15.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|