C49H84MoNO10- — CID 155743259
[3-[2-[3-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyundecoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 3-methylpyrrolidin-1-ide-3-carboxylate;molybdenum (PubChem CID 155743259) has the molecular formula C49H84MoNO10- and a molecular weight of 943.15 g/mol. Its IUPAC name is [3-[2-[3-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyundecoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 3-methylpyrrolidin-1-ide-3-carboxylate;molybdenum.
| Compound Name | [3-[2-[3-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyundecoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 3-methylpyrrolidin-1-ide-3-carboxylate;molybdenum |
|---|---|
| PubChem CID | 155743259 |
| Molecular Formula | C49H84MoNO10- |
| Molecular Weight | 943.15 g/mol |
| Exact Mass | 944.52 |
| IUPAC Name | [3-[2-[3-[7-hexanoyloxy-6-(hexanoyloxymethyl)heptanoyl]oxyundecoxy]-2-oxoethyl]-2-[(Z)-pent-2-enyl]cyclopentyl] 3-methylpyrrolidin-1-ide-3-carboxylate;molybdenum |
| SMILES | CC/C=C\CC1C(CC(=O)OCCC(CCCCCCCC)OC(=O)CCCCC(COC(=O)CCCCC)COC(=O)CCCCC)CCC1OC(=O)C1(C)CC[N-]C1.[Mo] |
| InChI | InChI=1S/C49H84NO10.Mo/c1-6-10-14-15-16-20-24-41(59-46(53)28-22-21-23-39(36-57-44(51)26-18-12-8-3)37-58-45(52)27-19-13-9-4)31-34-56-47(54)35-40-29-30-43(42(40)25-17-11-7-2)60-48(55)49(5)32-33-50-38-49;/h11,17,39-43H,6-10,12-16,18-38H2,1-5H3;/q-1;/b17-11-; |
| InChIKey | SQXZTNIGXWFHJN-CULRIWENSA-N |
| XLogP | 11.47 |
| TPSA | 145.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.15 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|