About bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate
bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate (PubChem CID 171604196) has the molecular formula C49H93NO7
and a molecular weight of 808.28 g/mol. Its IUPAC name is bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate.
Molecular Properties
| Compound Name | bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate |
| PubChem CID | 171604196 |
| Molecular Formula | C49H93NO7 |
| Molecular Weight | 808.28 g/mol |
| Exact Mass | 807.70 |
| IUPAC Name | bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCC(CCCCCCC(=O)OCCC(CCCCC)CCCCC)OC(=O)COC1CCN(C)CC1 |
| InChI | InChI=1S/C49H93NO7/c1-6-10-18-26-43(27-19-11-7-2)36-40-54-47(51)32-24-16-14-22-30-46(57-49(53)42-56-45-34-38-50(5)39-35-45)31-23-15-17-25-33-48(52)55-41-37-44(28-20-12-8-3)29-21-13-9-4/h43-46H,6-42H2,1-5H3 |
| InChIKey | JODFVAXUJKDRTA-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 808.28 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate?
The IUPAC name of bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate (CID 171604196) is bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate.
What is the SMILES notation for bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate?
The canonical SMILES for bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate is CCCCCC(CCCCC)CCOC(=O)CCCCCCC(CCCCCCC(=O)OCCC(CCCCC)CCCCC)OC(=O)COC1CCN(C)CC1.
What is the InChIKey of bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate?
The InChIKey is JODFVAXUJKDRTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C49H93NO7/c1-6-10-18-26-43(27-19-11-7-2)36-40-54-47(51)32-24-16-14-22-30-46(57-49(53)42-56-45-34-38-50(5)39-35-45)31-23-15-17-25-33-48(52)55-41-37-44(28-20-12-8-3)29-21-13-9-4/h43-46H,6-42H2,1-5H3.
What are the key properties of bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate?
bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate has a molecular weight of 808.28 g/mol, XLogP of 13.11, 40 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-pentyloctyl) 8-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxypentadecanedioate is sourced from PubChem (CID 171604196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).