About 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate
1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate (PubChem CID 171604162) has the molecular formula C48H91NO7
and a molecular weight of 794.26 g/mol. Its IUPAC name is 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate.
Molecular Properties
| Compound Name | 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate |
| PubChem CID | 171604162 |
| Molecular Formula | C48H91NO7 |
| Molecular Weight | 794.26 g/mol |
| Exact Mass | 793.68 |
| IUPAC Name | 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate |
| SMILES | CCCCCCCCOC(=O)CCCCCCCC(CCCCCCCC(=O)OC(CCCCCCC)CCCCCCC)OC(=O)COC1CCN(C)CC1 |
| InChI | InChI=1S/C48H91NO7/c1-5-8-11-14-23-30-41-53-46(50)35-28-21-15-19-26-33-45(56-48(52)42-54-43-37-39-49(4)40-38-43)34-27-20-16-22-29-36-47(51)55-44(31-24-17-12-9-6-2)32-25-18-13-10-7-3/h43-45H,5-42H2,1-4H3 |
| InChIKey | OBWANOUCYFTCLW-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 794.26 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate?
The IUPAC name of 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate (CID 171604162) is 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate.
What is the SMILES notation for 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate?
The canonical SMILES for 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate is CCCCCCCCOC(=O)CCCCCCCC(CCCCCCCC(=O)OC(CCCCCCC)CCCCCCC)OC(=O)COC1CCN(C)CC1.
What is the InChIKey of 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate?
The InChIKey is OBWANOUCYFTCLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H91NO7/c1-5-8-11-14-23-30-41-53-46(50)35-28-21-15-19-26-33-45(56-48(52)42-54-43-37-39-49(4)40-38-43)34-27-20-16-22-29-36-47(51)55-44(31-24-17-12-9-6-2)32-25-18-13-10-7-3/h43-45H,5-42H2,1-4H3.
What are the key properties of 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate?
1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate has a molecular weight of 794.26 g/mol, XLogP of 13.01, 40 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-octyl 17-O-pentadecan-8-yl 9-[2-(1-methylpiperidin-4-yl)oxyacetyl]oxyheptadecanedioate is sourced from PubChem (CID 171604162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).