C52H100N2O6 — CID 118403652
[10-[4-(4-methylpiperazin-1-yl)butanoyloxy]-17-(3-pentyloctanoyloxy)heptadecyl] 3-pentyloctanoate (PubChem CID 118403652) has the molecular formula C52H100N2O6 and a molecular weight of 849.38 g/mol. Its IUPAC name is [10-[4-(4-methylpiperazin-1-yl)butanoyloxy]-17-(3-pentyloctanoyloxy)heptadecyl] 3-pentyloctanoate.
| Compound Name | [10-[4-(4-methylpiperazin-1-yl)butanoyloxy]-17-(3-pentyloctanoyloxy)heptadecyl] 3-pentyloctanoate |
|---|---|
| PubChem CID | 118403652 |
| Molecular Formula | C52H100N2O6 |
| Molecular Weight | 849.38 g/mol |
| Exact Mass | 848.76 |
| IUPAC Name | [10-[4-(4-methylpiperazin-1-yl)butanoyloxy]-17-(3-pentyloctanoyloxy)heptadecyl] 3-pentyloctanoate |
| SMILES | CCCCCC(CCCCC)CC(=O)OCCCCCCCCCC(CCCCCCCOC(=O)CC(CCCCC)CCCCC)OC(=O)CCCN1CCN(C)CC1 |
| InChI | InChI=1S/C52H100N2O6/c1-6-10-22-31-47(32-23-11-7-2)45-51(56)58-43-28-20-16-14-15-18-26-35-49(60-50(55)37-30-38-54-41-39-53(5)40-42-54)36-27-19-17-21-29-44-59-52(57)46-48(33-24-12-8-3)34-25-13-9-4/h47-49H,6-46H2,1-5H3 |
| InChIKey | YJSWPNWKYVIIQS-UHFFFAOYSA-N |
| XLogP | 13.81 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.38 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|